C18H27NO5S — CID 141194551
(2R,4R)-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2-propan-2-ylpiperidine-1-carboxylic acid (PubChem CID 141194551) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is (2R,4R)-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2-propan-2-ylpiperidine-1-carboxylic acid.
| Compound Name | (2R,4R)-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2-propan-2-ylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141194551 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2R,4R)-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2-propan-2-ylpiperidine-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2CCN(C(=O)O)[C@@H](C(C)C)C2)cc1 |
| InChI | InChI=1S/C18H27NO5S/c1-13(2)17-12-15(8-10-19(17)18(20)21)9-11-24-25(22,23)16-6-4-14(3)5-7-16/h4-7,13,15,17H,8-12H2,1-3H3,(H,20,21)/t15-,17+/m0/s1 |
| InChIKey | GJHRROFPOLPWGT-DOTOQJQBSA-N |
| XLogP | 3.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|