C21H35N3O4S — CID 91287343
2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine (PubChem CID 91287343) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine.
| Compound Name | 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine |
|---|---|
| PubChem CID | 91287343 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine |
| SMILES | C=C(N(C)C)N(C)C.Cc1ccc(S(=O)(=O)OCCC2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C15H21NO4S.C6H14N2/c1-13-2-4-15(5-3-13)21(18,19)20-11-8-14-6-9-16(12-17)10-7-14;1-6(7(2)3)8(4)5/h2-5,12,14H,6-11H2,1H3;1H2,2-5H3 |
| InChIKey | VPUIIHNCUNNJSR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|