C21H32N2O6S2 — CID 59154183
methyl (2S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 59154183) has the molecular formula C21H32N2O6S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 59154183 |
| Molecular Formula | C21H32N2O6S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | methyl (2S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)N1CCC(CCOS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C21H32N2O6S2/c1-16-4-6-18(7-5-16)31(26,27)29-14-10-17-8-12-23(13-9-17)21(25)22-19(11-15-30-3)20(24)28-2/h4-7,17,19H,8-15H2,1-3H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | LHVSAFNDDSHIBB-IBGZPJMESA-N |
| XLogP | 2.81 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|