C18H27N3O3S — CID 3341859
methyl 2-[(4-benzylpiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoate (PubChem CID 3341859) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl 2-[(4-benzylpiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[(4-benzylpiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3341859 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | methyl 2-[(4-benzylpiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-24-17(22)16(8-13-25-2)19-18(23)21-11-9-20(10-12-21)14-15-6-4-3-5-7-15/h3-7,16H,8-14H2,1-2H3,(H,19,23) |
| InChIKey | CMAJIRGSIIOOPH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |