C11H20N2O4S — CID 3285258
methyl 4-methylsulfanyl-2-(morpholine-4-carbonylamino)butanoate (PubChem CID 3285258) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-(morpholine-4-carbonylamino)butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-(morpholine-4-carbonylamino)butanoate |
|---|---|
| PubChem CID | 3285258 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 4-methylsulfanyl-2-(morpholine-4-carbonylamino)butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H20N2O4S/c1-16-10(14)9(3-8-18-2)12-11(15)13-4-6-17-7-5-13/h9H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | QGZXOGNAYFGTJI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |