C17H24FN3O3S — CID 7584210
methyl (2S)-2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 7584210) has the molecular formula C17H24FN3O3S and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7584210 |
| Molecular Formula | C17H24FN3O3S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl (2S)-2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FN3O3S/c1-24-16(22)15(7-12-25-2)19-17(23)21-10-8-20(9-11-21)14-5-3-13(18)4-6-14/h3-6,15H,7-12H2,1-2H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | COCCQRPXFJKLKI-HNNXBMFYSA-N |
| XLogP | 1.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |