C16H25NO6S — CID 135207467
2-[2-(butoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 135207467) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-[2-(butoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(butoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135207467 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[2-(butoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCCOC(=O)NCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25NO6S/c1-3-4-10-22-16(18)17-9-11-21-12-13-23-24(19,20)15-7-5-14(2)6-8-15/h5-8H,3-4,9-13H2,1-2H3,(H,17,18) |
| InChIKey | UHMUQTOVYUMTGD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|