C21H34O4Si — CID 90184945
3-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-cyclopentylfuran-2,5-dione (PubChem CID 90184945) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-cyclopentylfuran-2,5-dione.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-cyclopentylfuran-2,5-dione |
|---|---|
| PubChem CID | 90184945 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-cyclopentylfuran-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C2=C(C3CCCC3)C(=O)OC2=O)CC1 |
| InChI | InChI=1S/C21H34O4Si/c1-21(2,3)26(4,5)25-16-12-10-15(11-13-16)18-17(14-8-6-7-9-14)19(22)24-20(18)23/h14-16H,6-13H2,1-5H3 |
| InChIKey | KXUUTKDWMXBEQZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|