C20H40OSi2 — CID 102582858
tert-butyl-dimethyl-[(1R)-3-(2-triethylsilylethenylidene)cyclohexyl]oxysilane (PubChem CID 102582858) has the molecular formula C20H40OSi2 and a molecular weight of 352.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-3-(2-triethylsilylethenylidene)cyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R)-3-(2-triethylsilylethenylidene)cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 102582858 |
| Molecular Formula | C20H40OSi2 |
| Molecular Weight | 352.71 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-3-(2-triethylsilylethenylidene)cyclohexyl]oxysilane |
| SMILES | CC[Si](C=C=C1CCC[C@@H](O[Si](C)(C)C(C)(C)C)C1)(CC)CC |
| InChI | InChI=1S/C20H40OSi2/c1-9-23(10-2,11-3)16-15-18-13-12-14-19(17-18)21-22(7,8)20(4,5)6/h16,19H,9-14,17H2,1-8H3/t15?,19-/m1/s1 |
| InChIKey | ZAQVHQTYMGQQLB-XCWJXAQQSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.71 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|