C15H27ClOSi — CID 101065781
tert-butyl-[(1S,4Z)-4-(2-chloroethylidene)-3-methylidenecyclohexyl]oxy-dimethylsilane (PubChem CID 101065781) has the molecular formula C15H27ClOSi and a molecular weight of 286.92 g/mol. Its IUPAC name is tert-butyl-[(1S,4Z)-4-(2-chloroethylidene)-3-methylidenecyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,4Z)-4-(2-chloroethylidene)-3-methylidenecyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101065781 |
| Molecular Formula | C15H27ClOSi |
| Molecular Weight | 286.92 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | tert-butyl-[(1S,4Z)-4-(2-chloroethylidene)-3-methylidenecyclohexyl]oxy-dimethylsilane |
| SMILES | C=C1C[C@@H](O[Si](C)(C)C(C)(C)C)CC/C1=C/CCl |
| InChI | InChI=1S/C15H27ClOSi/c1-12-11-14(8-7-13(12)9-10-16)17-18(5,6)15(2,3)4/h9,14H,1,7-8,10-11H2,2-6H3/b13-9-/t14-/m0/s1 |
| InChIKey | PXDMZYQAEDTHFZ-XXYUJHKVSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|