C15H26ClFOSi — CID 11243654
tert-butyl-[(1R,3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexyl]oxy-dimethylsilane (PubChem CID 11243654) has the molecular formula C15H26ClFOSi and a molecular weight of 304.91 g/mol. Its IUPAC name is tert-butyl-[(1R,3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11243654 |
| Molecular Formula | C15H26ClFOSi |
| Molecular Weight | 304.91 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | tert-butyl-[(1R,3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexyl]oxy-dimethylsilane |
| SMILES | C=C1/C(=C\CCl)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C15H26ClFOSi/c1-11-12(7-8-16)9-13(10-14(11)17)18-19(5,6)15(2,3)4/h7,13-14H,1,8-10H2,2-6H3/b12-7-/t13-,14+/m1/s1 |
| InChIKey | GKQXXODOWOZBOE-SADRXWBLSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|