C12H21Cl3O3Si — CID 15341503
(4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(trichloromethyl)oxan-2-one (PubChem CID 15341503) has the molecular formula C12H21Cl3O3Si and a molecular weight of 347.74 g/mol. Its IUPAC name is (4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(trichloromethyl)oxan-2-one.
| Compound Name | (4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(trichloromethyl)oxan-2-one |
|---|---|
| PubChem CID | 15341503 |
| Molecular Formula | C12H21Cl3O3Si |
| Molecular Weight | 347.74 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(trichloromethyl)oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)O[C@H](C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C12H21Cl3O3Si/c1-11(2,3)19(4,5)18-8-6-9(12(13,14)15)17-10(16)7-8/h8-9H,6-7H2,1-5H3/t8-,9+/m1/s1 |
| InChIKey | QPFQREKFNMYZNA-BDAKNGLRSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|