C21H42O4Si2 — CID 91520518
cis-methyl (3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1,2-dihydroxy-4-methylidenecyclohexane-1-carboxylate (PubChem CID 91520518) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is cis-methyl (3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1,2-dihydroxy-4-methylidenecyclohexane-1-carboxylate.
| Compound Name | cis-methyl (3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1,2-dihydroxy-4-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91520518 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | cis-methyl (3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1,2-dihydroxy-4-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1[C@H]([Si](C)(C)C(C)(C)C)CC(O)(C(=O)OC)C(O)[C@@H]1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si2/c1-14-15(26(9,10)19(2,3)4)13-21(24,18(23)25-8)17(22)16(14)27(11,12)20(5,6)7/h15-17,22,24H,1,13H2,2-12H3/t15-,16-,17?,21?/m1/s1 |
| InChIKey | ZDHRTMHGEBYPNH-UJZKCHAJSA-N |
| XLogP | 4.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|