C16H34O2Si — CID 11033471
cis-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methylcyclohexan-1-ol (PubChem CID 11033471) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is cis-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methylcyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11033471 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | cis-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-methylcyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@]1(C)CCCC[C@H]1O |
| InChI | InChI=1S/C16H34O2Si/c1-15(2,3)19(5,6)18-13-9-12-16(4)11-8-7-10-14(16)17/h14,17H,7-13H2,1-6H3/t14-,16-/m1/s1 |
| InChIKey | ZUTPCVZBSNGCNF-GDBMZVCRSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|