C15H29Cl3O5SSi — CID 138969959
[(2S,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-1,1,1-trichlorobutan-2-yl] methanesulfonate (PubChem CID 138969959) has the molecular formula C15H29Cl3O5SSi and a molecular weight of 455.90 g/mol. Its IUPAC name is [(2S,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-1,1,1-trichlorobutan-2-yl] methanesulfonate.
| Compound Name | [(2S,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-1,1,1-trichlorobutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 138969959 |
| Molecular Formula | C15H29Cl3O5SSi |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [(2S,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-1,1,1-trichlorobutan-2-yl] methanesulfonate |
| SMILES | C[C@@H]([C@H](OS(C)(=O)=O)C(Cl)(Cl)Cl)[C@@H]1O[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29Cl3O5SSi/c1-10(12(15(16,17)18)23-24(6,19)20)11-14(5,22-11)9-21-25(7,8)13(2,3)4/h10-12H,9H2,1-8H3/t10-,11+,12+,14+/m1/s1 |
| InChIKey | KLTUZGMHZHJPRW-UHXUPSOCSA-N |
| XLogP | 4.52 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|