C17H36O5SSi — CID 101052069
[(2R,3R)-2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]hexan-3-yl] methanesulfonate (PubChem CID 101052069) has the molecular formula C17H36O5SSi and a molecular weight of 380.62 g/mol. Its IUPAC name is [(2R,3R)-2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]hexan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R)-2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]hexan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 101052069 |
| Molecular Formula | C17H36O5SSi |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(2R,3R)-2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]hexan-3-yl] methanesulfonate |
| SMILES | CCC[C@@H](OS(C)(=O)=O)[C@H](C)[C@@H]1O[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O5SSi/c1-10-11-14(22-23(7,18)19)13(2)15-17(6,21-15)12-20-24(8,9)16(3,4)5/h13-15H,10-12H2,1-9H3/t13-,14+,15-,17-/m0/s1 |
| InChIKey | VPCBNRZAEHKTDP-IVSAIRAKSA-N |
| XLogP | 3.95 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|