C16H31NO2Si — CID 71500581
(3R)-5-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpentanenitrile (PubChem CID 71500581) has the molecular formula C16H31NO2Si and a molecular weight of 297.52 g/mol. Its IUPAC name is (3R)-5-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpentanenitrile.
| Compound Name | (3R)-5-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpentanenitrile |
|---|---|
| PubChem CID | 71500581 |
| Molecular Formula | C16H31NO2Si |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (3R)-5-[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-3-methylpentanenitrile |
| SMILES | C[C@@H](CC#N)CC[C@H]1O[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO2Si/c1-13(10-11-17)8-9-14-16(5,19-14)12-18-20(6,7)15(2,3)4/h13-14H,8-10,12H2,1-7H3/t13-,14-,16-/m1/s1 |
| InChIKey | PWQUDYZDCXQOHN-IIAWOOMASA-N |
| XLogP | 4.50 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|