C12H24O2 — CID 11790226
[(2S,3S)-3-[(3S)-3,5-dimethylhexyl]-2-methyloxiran-2-yl]methanol (PubChem CID 11790226) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is [(2S,3S)-3-[(3S)-3,5-dimethylhexyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(3S)-3,5-dimethylhexyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11790226 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | [(2S,3S)-3-[(3S)-3,5-dimethylhexyl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC(C)C[C@@H](C)CC[C@@H]1O[C@@]1(C)CO |
| InChI | InChI=1S/C12H24O2/c1-9(2)7-10(3)5-6-11-12(4,8-13)14-11/h9-11,13H,5-8H2,1-4H3/t10-,11-,12-/m0/s1 |
| InChIKey | AAIWLMMNXDWORR-SRVKXCTJSA-N |
| XLogP | 2.60 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|