C10H20O3 — CID 135084125
2-[2-(3,3-dimethyloxiran-2-yl)ethyl]butane-1,4-diol (PubChem CID 135084125) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[2-(3,3-dimethyloxiran-2-yl)ethyl]butane-1,4-diol.
| Compound Name | 2-[2-(3,3-dimethyloxiran-2-yl)ethyl]butane-1,4-diol |
|---|---|
| PubChem CID | 135084125 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-[2-(3,3-dimethyloxiran-2-yl)ethyl]butane-1,4-diol |
| SMILES | CC1(C)OC1CCC(CO)CCO |
| InChI | InChI=1S/C10H20O3/c1-10(2)9(13-10)4-3-8(7-12)5-6-11/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | DJIAPDQIVKFQGM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|