C15H28O2 — CID 172640700
(2R,3R)-2-ethyl-2-[2-[(2R,3R)-3-ethyl-3-(2-methylpropyl)oxiran-2-yl]ethyl]-3-methyloxirane (PubChem CID 172640700) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-2-[2-[(2R,3R)-3-ethyl-3-(2-methylpropyl)oxiran-2-yl]ethyl]-3-methyloxirane.
| Compound Name | (2R,3R)-2-ethyl-2-[2-[(2R,3R)-3-ethyl-3-(2-methylpropyl)oxiran-2-yl]ethyl]-3-methyloxirane |
|---|---|
| PubChem CID | 172640700 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2R,3R)-2-ethyl-2-[2-[(2R,3R)-3-ethyl-3-(2-methylpropyl)oxiran-2-yl]ethyl]-3-methyloxirane |
| SMILES | CC[C@]1(CC[C@H]2O[C@]2(CC)CC(C)C)O[C@@H]1C |
| InChI | InChI=1S/C15H28O2/c1-6-14(12(5)16-14)9-8-13-15(7-2,17-13)10-11(3)4/h11-13H,6-10H2,1-5H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | VPENCPTXKGWVMP-KBUPBQIOSA-N |
| XLogP | 3.93 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|