C16H34O9S2Si — CID 73026809
[5-[2-[tert-butyl(dimethyl)silyl]oxy-1-methylsulfonyloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 73026809) has the molecular formula C16H34O9S2Si and a molecular weight of 462.66 g/mol. Its IUPAC name is [5-[2-[tert-butyl(dimethyl)silyl]oxy-1-methylsulfonyloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [5-[2-[tert-butyl(dimethyl)silyl]oxy-1-methylsulfonyloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 73026809 |
| Molecular Formula | C16H34O9S2Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [5-[2-[tert-butyl(dimethyl)silyl]oxy-1-methylsulfonyloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1(C)OC(COS(C)(=O)=O)C(C(CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O)O1 |
| InChI | InChI=1S/C16H34O9S2Si/c1-15(2,3)28(8,9)22-11-13(25-27(7,19)20)14-12(10-21-26(6,17)18)23-16(4,5)24-14/h12-14H,10-11H2,1-9H3 |
| InChIKey | CESZPOFMJWODIR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|