C15H32O6S2Si — CID 151398547
[1-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-ylsulfonyl]cyclopropyl]methyl methanesulfonate (PubChem CID 151398547) has the molecular formula C15H32O6S2Si and a molecular weight of 400.64 g/mol. Its IUPAC name is [1-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-ylsulfonyl]cyclopropyl]methyl methanesulfonate.
| Compound Name | [1-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-ylsulfonyl]cyclopropyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 151398547 |
| Molecular Formula | C15H32O6S2Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [1-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-ylsulfonyl]cyclopropyl]methyl methanesulfonate |
| SMILES | CC(CCO[Si](C)(C)C(C)(C)C)S(=O)(=O)C1(COS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H32O6S2Si/c1-13(8-11-21-24(6,7)14(2,3)4)23(18,19)15(9-10-15)12-20-22(5,16)17/h13H,8-12H2,1-7H3 |
| InChIKey | OVZIAQYGVUJSAP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|