C35H48O4 — CID 139782913
diethyl 2-(3-naphthalen-2-ylpropyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate (PubChem CID 139782913) has the molecular formula C35H48O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is diethyl 2-(3-naphthalen-2-ylpropyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate.
| Compound Name | diethyl 2-(3-naphthalen-2-ylpropyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate |
|---|---|
| PubChem CID | 139782913 |
| Molecular Formula | C35H48O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | diethyl 2-(3-naphthalen-2-ylpropyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)propanedioate |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)(CCCc1ccc2ccccc2c1)C(=O)OCC |
| InChI | InChI=1S/C35H48O4/c1-7-38-33(36)35(34(37)39-8-2,24-13-18-30-21-22-31-19-9-10-20-32(31)26-30)25-23-29(6)17-12-16-28(5)15-11-14-27(3)4/h9-10,14,16,19-23,26H,7-8,11-13,15,17-18,24-25H2,1-6H3 |
| InChIKey | ZDFHRTPSIJTPDT-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|