C23H27F3O6 — CID 102474500
diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate (PubChem CID 102474500) has the molecular formula C23H27F3O6 and a molecular weight of 456.46 g/mol. Its IUPAC name is diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102474500 |
| Molecular Formula | C23H27F3O6 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/COC(C)=O)(C/C=C/c1cccc(C(F)(F)F)c1)C(=O)OCC |
| InChI | InChI=1S/C23H27F3O6/c1-4-30-20(28)22(21(29)31-5-2,13-6-7-15-32-17(3)27)14-9-11-18-10-8-12-19(16-18)23(24,25)26/h6-12,16H,4-5,13-15H2,1-3H3/b7-6+,11-9+ |
| InChIKey | HETMHRRMSDLFAV-RXUIJTJXSA-N |
| XLogP | 4.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|