C21H27IO7 — CID 59747108
diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(2-iodo-5-methoxyphenyl)methyl]propanedioate (PubChem CID 59747108) has the molecular formula C21H27IO7 and a molecular weight of 518.34 g/mol. Its IUPAC name is diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(2-iodo-5-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(2-iodo-5-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 59747108 |
| Molecular Formula | C21H27IO7 |
| Molecular Weight | 518.34 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | diethyl 2-[(E)-4-acetyloxybut-2-enyl]-2-[(2-iodo-5-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/COC(C)=O)(Cc1cc(OC)ccc1I)C(=O)OCC |
| InChI | InChI=1S/C21H27IO7/c1-5-27-19(24)21(20(25)28-6-2,11-7-8-12-29-15(3)23)14-16-13-17(26-4)9-10-18(16)22/h7-10,13H,5-6,11-12,14H2,1-4H3/b8-7+ |
| InChIKey | WLLRXRGGTIJWCD-BQYQJAHWSA-N |
| XLogP | 3.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|