C22H29NO6 — CID 135073951
diethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-[(5-methoxy-1-methylindol-2-yl)methyl]propanedioate (PubChem CID 135073951) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is diethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-[(5-methoxy-1-methylindol-2-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-[(5-methoxy-1-methylindol-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 135073951 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | diethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-[(5-methoxy-1-methylindol-2-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C\CO)(Cc1cc2cc(OC)ccc2n1C)C(=O)OCC |
| InChI | InChI=1S/C22H29NO6/c1-5-28-20(25)22(11-7-8-12-24,21(26)29-6-2)15-17-13-16-14-18(27-4)9-10-19(16)23(17)3/h7-10,13-14,24H,5-6,11-12,15H2,1-4H3/b8-7- |
| InChIKey | CGLIFMDTDHTHOE-FPLPWBNLSA-N |
| XLogP | 2.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|