C19H23NO4 — CID 101402235
dimethyl 2-but-3-enyl-2-[(1-methylindol-2-yl)methyl]propanedioate (PubChem CID 101402235) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is dimethyl 2-but-3-enyl-2-[(1-methylindol-2-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-but-3-enyl-2-[(1-methylindol-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 101402235 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | dimethyl 2-but-3-enyl-2-[(1-methylindol-2-yl)methyl]propanedioate |
| SMILES | C=CCCC(Cc1cc2ccccc2n1C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H23NO4/c1-5-6-11-19(17(21)23-3,18(22)24-4)13-15-12-14-9-7-8-10-16(14)20(15)2/h5,7-10,12H,1,6,11,13H2,2-4H3 |
| InChIKey | GXZOGLDGVFYUBY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|