C20H26O3 — CID 21354872
ethyl 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoate (PubChem CID 21354872) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoate.
| Compound Name | ethyl 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 21354872 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethyl 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoate |
| SMILES | CCOC(=O)C(C)(C)C(CC)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H26O3/c1-6-18(20(3,4)19(21)23-7-2)16-9-8-15-13-17(22-5)11-10-14(15)12-16/h8-13,18H,6-7H2,1-5H3 |
| InChIKey | CKXPXHNNDRINHS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |