C38H47IO10 — CID 158114335
diethyl 2-[(Z)-4-acetyloxybut-2-enyl]-2-[(2-iodophenyl)methyl]propanedioate;diethyl 4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 158114335) has the molecular formula C38H47IO10 and a molecular weight of 790.69 g/mol. Its IUPAC name is diethyl 2-[(Z)-4-acetyloxybut-2-enyl]-2-[(2-iodophenyl)methyl]propanedioate;diethyl 4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 2-[(Z)-4-acetyloxybut-2-enyl]-2-[(2-iodophenyl)methyl]propanedioate;diethyl 4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 158114335 |
| Molecular Formula | C38H47IO10 |
| Molecular Weight | 790.69 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | diethyl 2-[(Z)-4-acetyloxybut-2-enyl]-2-[(2-iodophenyl)methyl]propanedioate;diethyl 4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OCC)(C(=O)OCC)Cc2ccccc21.CCOC(=O)C(C/C=C\COC(C)=O)(Cc1ccccc1I)C(=O)OCC |
| InChI | InChI=1S/C20H25IO6.C18H22O4/c1-4-25-18(23)20(19(24)26-5-2,12-8-9-13-27-15(3)22)14-16-10-6-7-11-17(16)21;1-4-13-11-18(16(19)21-5-2,17(20)22-6-3)12-14-9-7-8-10-15(13)14/h6-11H,4-5,12-14H2,1-3H3;4,7-10,13H,1,5-6,11-12H2,2-3H3/b9-8-; |
| InChIKey | FQUUFHPEEBGDHP-UOQXYWCXSA-N |
| XLogP | 6.47 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|