C26H26F3NO2S — CID 135072741
4-methoxy-N-[(2S,3S)-1,1,1-trifluoro-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hex-5-en-2-yl]aniline (PubChem CID 135072741) has the molecular formula C26H26F3NO2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-methoxy-N-[(2S,3S)-1,1,1-trifluoro-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hex-5-en-2-yl]aniline.
| Compound Name | 4-methoxy-N-[(2S,3S)-1,1,1-trifluoro-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hex-5-en-2-yl]aniline |
|---|---|
| PubChem CID | 135072741 |
| Molecular Formula | C26H26F3NO2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-methoxy-N-[(2S,3S)-1,1,1-trifluoro-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]hex-5-en-2-yl]aniline |
| SMILES | C=CC[C@@H](c1ccccc1[S@@](=O)c1ccc(C)cc1)[C@H](Nc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F3NO2S/c1-4-7-23(25(26(27,28)29)30-19-12-14-20(32-3)15-13-19)22-8-5-6-9-24(22)33(31)21-16-10-18(2)11-17-21/h4-6,8-17,23,25,30H,1,7H2,2-3H3/t23-,25-,33-/m0/s1 |
| InChIKey | WRIJLCSJXLXZRE-ZZEPOTGUSA-N |
| XLogP | 6.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|