About N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline
N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline (PubChem CID 101431872) has the molecular formula C29H29NO2S
and a molecular weight of 455.62 g/mol. Its IUPAC name is N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline.
Molecular Properties
| Compound Name | N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline |
| PubChem CID | 101431872 |
| Molecular Formula | C29H29NO2S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline |
| SMILES | COc1ccc([C@H](Nc2ccccc2)[C@@H](C)c2ccccc2S(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H29NO2S/c1-21-13-19-26(20-14-21)33(31)28-12-8-7-11-27(28)22(2)29(30-24-9-5-4-6-10-24)23-15-17-25(32-3)18-16-23/h4-20,22,29-30H,1-3H3/t22-,29+,33?/m0/s1 |
| InChIKey | NWUPELHJZPOBPV-MCXTZKLKSA-N |
| XLogP | 7.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline?
The IUPAC name of N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline (CID 101431872) is N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline.
What is the SMILES notation for N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline?
The canonical SMILES for N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline is COc1ccc([C@H](Nc2ccccc2)[C@@H](C)c2ccccc2S(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline?
The InChIKey is NWUPELHJZPOBPV-MCXTZKLKSA-N. The full InChI is InChI=1S/C29H29NO2S/c1-21-13-19-26(20-14-21)33(31)28-12-8-7-11-27(28)22(2)29(30-24-9-5-4-6-10-24)23-15-17-25(32-3)18-16-23/h4-20,22,29-30H,1-3H3/t22-,29+,33?/m0/s1.
What are the key properties of N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline?
N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline has a molecular weight of 455.62 g/mol, XLogP of 7.13, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-1-(4-methoxyphenyl)-2-[2-(4-methylphenyl)sulfinylphenyl]propyl]aniline is sourced from PubChem (CID 101431872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).