C16H18N2O2 — CID 102422262
N-[(1R,2R)-1-(4-methylphenyl)-2-nitropropyl]aniline (PubChem CID 102422262) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-[(1R,2R)-1-(4-methylphenyl)-2-nitropropyl]aniline.
| Compound Name | N-[(1R,2R)-1-(4-methylphenyl)-2-nitropropyl]aniline |
|---|---|
| PubChem CID | 102422262 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[(1R,2R)-1-(4-methylphenyl)-2-nitropropyl]aniline |
| SMILES | Cc1ccc([C@@H](Nc2ccccc2)[C@@H](C)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-12-8-10-14(11-9-12)16(13(2)18(19)20)17-15-6-4-3-5-7-15/h3-11,13,16-17H,1-2H3/t13-,16+/m1/s1 |
| InChIKey | XAAZYXPPGXCWKI-CJNGLKHVSA-N |
| XLogP | 3.81 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|