C15H15BrOS — CID 102282736
1-[(1R)-1-bromoethyl]-2-(4-methylphenyl)sulfinylbenzene (PubChem CID 102282736) has the molecular formula C15H15BrOS and a molecular weight of 323.26 g/mol. Its IUPAC name is 1-[(1R)-1-bromoethyl]-2-(4-methylphenyl)sulfinylbenzene.
| Compound Name | 1-[(1R)-1-bromoethyl]-2-(4-methylphenyl)sulfinylbenzene |
|---|---|
| PubChem CID | 102282736 |
| Molecular Formula | C15H15BrOS |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 1-[(1R)-1-bromoethyl]-2-(4-methylphenyl)sulfinylbenzene |
| SMILES | Cc1ccc(S(=O)c2ccccc2[C@@H](C)Br)cc1 |
| InChI | InChI=1S/C15H15BrOS/c1-11-7-9-13(10-8-11)18(17)15-6-4-3-5-14(15)12(2)16/h3-10,12H,1-2H3/t12-,18?/m1/s1 |
| InChIKey | BQXHIWLHYDEAMI-GKOGFXNCSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|