C22H20N2O3S2 — CID 16754095
N-[(S)-cyano-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 16754095) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(S)-cyano-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(S)-cyano-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 16754095 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[(S)-cyano-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc([S@](=O)c2ccccc2[C@@H](C#N)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O3S2/c1-16-7-11-18(12-8-16)28(25)22-6-4-3-5-20(22)21(15-23)24-29(26,27)19-13-9-17(2)10-14-19/h3-14,21,24H,1-2H3/t21-,28+/m1/s1 |
| InChIKey | OYVSGHMEFQFNOD-PIKZIKFNSA-N |
| XLogP | 4.01 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |