C19H19NOS — CID 102292041
(E)-2-[2-(4-methylphenyl)sulfinylphenyl]hex-4-enenitrile (PubChem CID 102292041) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is (E)-2-[2-(4-methylphenyl)sulfinylphenyl]hex-4-enenitrile.
| Compound Name | (E)-2-[2-(4-methylphenyl)sulfinylphenyl]hex-4-enenitrile |
|---|---|
| PubChem CID | 102292041 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (E)-2-[2-(4-methylphenyl)sulfinylphenyl]hex-4-enenitrile |
| SMILES | C/C=C/CC(C#N)c1ccccc1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NOS/c1-3-4-7-16(14-20)18-8-5-6-9-19(18)22(21)17-12-10-15(2)11-13-17/h3-6,8-13,16H,7H2,1-2H3/b4-3+ |
| InChIKey | YPJSAQNREZUKDU-ONEGZZNKSA-N |
| XLogP | 4.74 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|