C18H22O2S — CID 101071114
(3S)-2-methyl-3-[2-(4-methylphenyl)sulfinylphenyl]butan-2-ol (PubChem CID 101071114) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is (3S)-2-methyl-3-[2-(4-methylphenyl)sulfinylphenyl]butan-2-ol.
| Compound Name | (3S)-2-methyl-3-[2-(4-methylphenyl)sulfinylphenyl]butan-2-ol |
|---|---|
| PubChem CID | 101071114 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3S)-2-methyl-3-[2-(4-methylphenyl)sulfinylphenyl]butan-2-ol |
| SMILES | Cc1ccc(S(=O)c2ccccc2[C@H](C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C18H22O2S/c1-13-9-11-15(12-10-13)21(20)17-8-6-5-7-16(17)14(2)18(3,4)19/h5-12,14,19H,1-4H3/t14-,21?/m0/s1 |
| InChIKey | QFANRURBVBOFBH-YXWRBFHGSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |