C19H22O2S — CID 25216070
(3S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]pent-1-en-3-ol (PubChem CID 25216070) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is (3S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]pent-1-en-3-ol.
| Compound Name | (3S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 25216070 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (3S)-4-methyl-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]pent-1-en-3-ol |
| SMILES | C=C(c1ccccc1[S@@](=O)c1ccc(C)cc1)[C@@H](O)C(C)C |
| InChI | InChI=1S/C19H22O2S/c1-13(2)19(20)15(4)17-7-5-6-8-18(17)22(21)16-11-9-14(3)10-12-16/h5-13,19-20H,4H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | KWLYVGOWBWSXDX-UGKGYDQZSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |