C19H22O2SSe — CID 10992874
4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-4-phenylselanylpent-1-en-3-ol (PubChem CID 10992874) has the molecular formula C19H22O2SSe and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-4-phenylselanylpent-1-en-3-ol.
| Compound Name | 4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-4-phenylselanylpent-1-en-3-ol |
|---|---|
| PubChem CID | 10992874 |
| Molecular Formula | C19H22O2SSe |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-4-phenylselanylpent-1-en-3-ol |
| SMILES | C=C(C(O)C(C)(C)[Se]c1ccccc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22O2SSe/c1-14-10-12-16(13-11-14)22(21)15(2)18(20)19(3,4)23-17-8-6-5-7-9-17/h5-13,18,20H,2H2,1,3-4H3/t18?,22-/m1/s1 |
| InChIKey | QBDONGOLXAQBRU-LMNIDFBRSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|