C17H20O2S — CID 11380685
(2R,3S)-3-[(R)-(4-methylphenyl)sulfinyl]-2-phenylbutan-2-ol (PubChem CID 11380685) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is (2R,3S)-3-[(R)-(4-methylphenyl)sulfinyl]-2-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-[(R)-(4-methylphenyl)sulfinyl]-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 11380685 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (2R,3S)-3-[(R)-(4-methylphenyl)sulfinyl]-2-phenylbutan-2-ol |
| SMILES | Cc1ccc([S@](=O)[C@@H](C)[C@](C)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O2S/c1-13-9-11-16(12-10-13)20(19)14(2)17(3,18)15-7-5-4-6-8-15/h4-12,14,18H,1-3H3/t14-,17-,20+/m0/s1 |
| InChIKey | VVDAVIYBYQUADW-GZRFBZBPSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |