C25H30O2SSi — CID 10502363
(3R)-2-methyl-4-[methyl(diphenyl)silyl]-3-[(R)-(4-methylphenyl)sulfinyl]butan-2-ol (PubChem CID 10502363) has the molecular formula C25H30O2SSi and a molecular weight of 422.67 g/mol. Its IUPAC name is (3R)-2-methyl-4-[methyl(diphenyl)silyl]-3-[(R)-(4-methylphenyl)sulfinyl]butan-2-ol.
| Compound Name | (3R)-2-methyl-4-[methyl(diphenyl)silyl]-3-[(R)-(4-methylphenyl)sulfinyl]butan-2-ol |
|---|---|
| PubChem CID | 10502363 |
| Molecular Formula | C25H30O2SSi |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (3R)-2-methyl-4-[methyl(diphenyl)silyl]-3-[(R)-(4-methylphenyl)sulfinyl]butan-2-ol |
| SMILES | Cc1ccc([S@](=O)[C@@H](C[Si](C)(c2ccccc2)c2ccccc2)C(C)(C)O)cc1 |
| InChI | InChI=1S/C25H30O2SSi/c1-20-15-17-21(18-16-20)28(27)24(25(2,3)26)19-29(4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,24,26H,19H2,1-4H3/t24-,28-/m0/s1 |
| InChIKey | SZHUARDYDZPKBJ-CUBQBAPOSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|