C16H19NO2Si — CID 10379208
(2R)-2-amino-3-[methyl(diphenyl)silyl]propanoic acid (PubChem CID 10379208) has the molecular formula C16H19NO2Si and a molecular weight of 285.42 g/mol. Its IUPAC name is (2R)-2-amino-3-[methyl(diphenyl)silyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[methyl(diphenyl)silyl]propanoic acid |
|---|---|
| PubChem CID | 10379208 |
| Molecular Formula | C16H19NO2Si |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R)-2-amino-3-[methyl(diphenyl)silyl]propanoic acid |
| SMILES | C[Si](C[C@H](N)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO2Si/c1-20(12-15(17)16(18)19,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,12,17H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | CDCWLXMQLLRGSX-HNNXBMFYSA-N |
| XLogP | 1.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|