C19H25NO2SSi — CID 91484655
2-amino-3-[3-[methyl(diphenyl)silyl]propylsulfanyl]propanoic acid (PubChem CID 91484655) has the molecular formula C19H25NO2SSi and a molecular weight of 359.57 g/mol. Its IUPAC name is 2-amino-3-[3-[methyl(diphenyl)silyl]propylsulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[3-[methyl(diphenyl)silyl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 91484655 |
| Molecular Formula | C19H25NO2SSi |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-amino-3-[3-[methyl(diphenyl)silyl]propylsulfanyl]propanoic acid |
| SMILES | C[Si](CCCSCC(N)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2SSi/c1-24(16-9-4-2-5-10-16,17-11-6-3-7-12-17)14-8-13-23-15-18(20)19(21)22/h2-7,9-12,18H,8,13-15,20H2,1H3,(H,21,22) |
| InChIKey | OKEITVUIWYOWSP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|