C25H29NO2SSi — CID 91502795
2-amino-3-(4-triphenylsilylbutylsulfanyl)propanoic acid (PubChem CID 91502795) has the molecular formula C25H29NO2SSi and a molecular weight of 435.67 g/mol. Its IUPAC name is 2-amino-3-(4-triphenylsilylbutylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(4-triphenylsilylbutylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 91502795 |
| Molecular Formula | C25H29NO2SSi |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-amino-3-(4-triphenylsilylbutylsulfanyl)propanoic acid |
| SMILES | NC(CSCCCC[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H29NO2SSi/c26-24(25(27)28)20-29-18-10-11-19-30(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-9,12-17,24H,10-11,18-20,26H2,(H,27,28) |
| InChIKey | OEABDXCBYVMPNB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|