C24H27NO2SSi — CID 25120940
(2R)-2-amino-3-(3-triphenylsilylpropylsulfanyl)propanoic acid (PubChem CID 25120940) has the molecular formula C24H27NO2SSi and a molecular weight of 421.64 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-triphenylsilylpropylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(3-triphenylsilylpropylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 25120940 |
| Molecular Formula | C24H27NO2SSi |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (2R)-2-amino-3-(3-triphenylsilylpropylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSCCC[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H27NO2SSi/c25-23(24(26)27)19-28-17-10-18-29(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23H,10,17-19,25H2,(H,26,27)/t23-/m0/s1 |
| InChIKey | WBYFOGWRLDINMR-QHCPKHFHSA-N |
| XLogP | 2.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|