C16H25NO3SSi — CID 91519028
2-acetamido-3-[3-[dimethyl(phenyl)silyl]propylsulfanyl]propanoic acid (PubChem CID 91519028) has the molecular formula C16H25NO3SSi and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-acetamido-3-[3-[dimethyl(phenyl)silyl]propylsulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[3-[dimethyl(phenyl)silyl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 91519028 |
| Molecular Formula | C16H25NO3SSi |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-acetamido-3-[3-[dimethyl(phenyl)silyl]propylsulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSCCC[Si](C)(C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H25NO3SSi/c1-13(18)17-15(16(19)20)12-21-10-7-11-22(2,3)14-8-5-4-6-9-14/h4-6,8-9,15H,7,10-12H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | XSDGPAQCHRABSN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|