C11H15NO3S2 — CID 107774768
(2R)-2-acetamido-3-(2-thiophen-2-ylethylsulfanyl)propanoic acid (PubChem CID 107774768) has the molecular formula C11H15NO3S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(2-thiophen-2-ylethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(2-thiophen-2-ylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 107774768 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | (2R)-2-acetamido-3-(2-thiophen-2-ylethylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCc1cccs1)C(=O)O |
| InChI | InChI=1S/C11H15NO3S2/c1-8(13)12-10(11(14)15)7-16-6-4-9-3-2-5-17-9/h2-3,5,10H,4,6-7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | GUILMUWBOAQPTK-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|