C11H23NO4SSi — CID 23534251
2-acetamido-3-[3-[methoxy(dimethyl)silyl]propylsulfanyl]propanoic acid (PubChem CID 23534251) has the molecular formula C11H23NO4SSi and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-acetamido-3-[3-[methoxy(dimethyl)silyl]propylsulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[3-[methoxy(dimethyl)silyl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 23534251 |
| Molecular Formula | C11H23NO4SSi |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-acetamido-3-[3-[methoxy(dimethyl)silyl]propylsulfanyl]propanoic acid |
| SMILES | CO[Si](C)(C)CCCSCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C11H23NO4SSi/c1-9(13)12-10(11(14)15)8-17-6-5-7-18(3,4)16-2/h10H,5-8H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | ZNGXIPSOXKBLKW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|