C12H15NO2S — CID 10037170
(2S,3S)-2-hydroxy-2-methyl-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile (PubChem CID 10037170) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-2-methyl-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile.
| Compound Name | (2S,3S)-2-hydroxy-2-methyl-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile |
|---|---|
| PubChem CID | 10037170 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2S,3S)-2-hydroxy-2-methyl-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile |
| SMILES | Cc1ccc([S@](=O)[C@@H](C)[C@@](C)(O)C#N)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-9-4-6-11(7-5-9)16(15)10(2)12(3,14)8-13/h4-7,10,14H,1-3H3/t10-,12-,16+/m0/s1 |
| InChIKey | MGVWDZQXAXWICQ-KNHMANMVSA-N |
| XLogP | 1.77 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|