C11H13NO2S — CID 11020514
(2S,3R)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile (PubChem CID 11020514) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (2S,3R)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile.
| Compound Name | (2S,3R)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile |
|---|---|
| PubChem CID | 11020514 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (2S,3R)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]butanenitrile |
| SMILES | Cc1ccc([S@](=O)[C@H](C)[C@@H](O)C#N)cc1 |
| InChI | InChI=1S/C11H13NO2S/c1-8-3-5-10(6-4-8)15(14)9(2)11(13)7-12/h3-6,9,11,13H,1-2H3/t9-,11+,15-/m1/s1 |
| InChIKey | TWNSIWAYQZXPAC-BPYAMOTFSA-N |
| XLogP | 1.38 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|