C15H21NO2S — CID 10265631
(2R)-2-hydroxy-3,3-dimethyl-2-[(1R)-1-[(R)-(4-methylphenyl)sulfinyl]ethyl]butanenitrile (PubChem CID 10265631) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is (2R)-2-hydroxy-3,3-dimethyl-2-[(1R)-1-[(R)-(4-methylphenyl)sulfinyl]ethyl]butanenitrile.
| Compound Name | (2R)-2-hydroxy-3,3-dimethyl-2-[(1R)-1-[(R)-(4-methylphenyl)sulfinyl]ethyl]butanenitrile |
|---|---|
| PubChem CID | 10265631 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2R)-2-hydroxy-3,3-dimethyl-2-[(1R)-1-[(R)-(4-methylphenyl)sulfinyl]ethyl]butanenitrile |
| SMILES | Cc1ccc([S@](=O)[C@H](C)[C@](O)(C#N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-11-6-8-13(9-7-11)19(18)12(2)15(17,10-16)14(3,4)5/h6-9,12,17H,1-5H3/t12-,15-,19-/m1/s1 |
| InChIKey | APFYMWWNLSJBDG-KPAZRMRSSA-N |
| XLogP | 2.79 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|